C65H120 — CID 20679600
28-(1,2-dimethylcyclobutyl)-3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,27,28,31-pentacosamethylpentacyclo[21.11.0.024,27.025,34.026,29]tetratriacontane (PubChem CID 20679600) has the molecular formula C65H120 and a molecular weight of 901.67 g/mol. Its IUPAC name is 28-(1,2-dimethylcyclobutyl)-3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,27,28,31-pentacosamethylpentacyclo[21.11.0.024,27.025,34.026,29]tetratriacontane.
| Compound Name | 28-(1,2-dimethylcyclobutyl)-3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,27,28,31-pentacosamethylpentacyclo[21.11.0.024,27.025,34.026,29]tetratriacontane |
|---|---|
| PubChem CID | 20679600 |
| Molecular Formula | C65H120 |
| Molecular Weight | 901.67 g/mol |
| Exact Mass | 900.94 |
| IUPAC Name | 28-(1,2-dimethylcyclobutyl)-3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,27,28,31-pentacosamethylpentacyclo[21.11.0.024,27.025,34.026,29]tetratriacontane |
| SMILES | CC1CCC2C3CC(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C3(C)C3(C)C2C2C(C1)C(C)(C1(C)CCC1C)C23C |
| InChI | InChI=1S/C65H120/c1-34-28-29-56-57-33-35(2)37(4)38(5)39(6)40(7)41(8)42(9)43(10)44(11)45(12)46(13)47(14)48(15)49(16)50(17)51(18)52(19)53(20)54(21)55(22)62(57,24)64(26)59(56)60-58(32-34)63(25,65(60,64)27)61(23)31-30-36(61)3/h34-60H,28-33H2,1-27H3 |
| InChIKey | PBECUHJXOWFWFX-UHFFFAOYSA-N |
| XLogP | 19.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.67 |
| LogP ≤ 5 | 19.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |