C24H42 — CID 90978846
(3S,11bS)-3,9,9,10,10a,11,11b-heptamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,10,11,11a-tetradecahydrobenzo[a]fluorene (PubChem CID 90978846) has the molecular formula C24H42 and a molecular weight of 330.60 g/mol. Its IUPAC name is (3S,11bS)-3,9,9,10,10a,11,11b-heptamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,10,11,11a-tetradecahydrobenzo[a]fluorene.
| Compound Name | (3S,11bS)-3,9,9,10,10a,11,11b-heptamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,10,11,11a-tetradecahydrobenzo[a]fluorene |
|---|---|
| PubChem CID | 90978846 |
| Molecular Formula | C24H42 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 330.33 |
| IUPAC Name | (3S,11bS)-3,9,9,10,10a,11,11b-heptamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,10,11,11a-tetradecahydrobenzo[a]fluorene |
| SMILES | CC1C2C(CCC3C[C@@H](C)CC[C@@]32C)C2CCC(C)(C)C(C)C12C |
| InChI | InChI=1S/C24H42/c1-15-10-13-23(6)18(14-15)8-9-19-20-11-12-22(4,5)17(3)24(20,7)16(2)21(19)23/h15-21H,8-14H2,1-7H3/t15-,16?,17?,18?,19?,20?,21?,23-,24?/m0/s1 |
| InChIKey | XKKWYPCZTXEUSW-XTYXIWIRSA-N |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |