C24H42 — CID 22958862
3,10,12,13,16,16,17-heptamethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthrene (PubChem CID 22958862) has the molecular formula C24H42 and a molecular weight of 330.60 g/mol. Its IUPAC name is 3,10,12,13,16,16,17-heptamethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthrene.
| Compound Name | 3,10,12,13,16,16,17-heptamethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 22958862 |
| Molecular Formula | C24H42 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 330.33 |
| IUPAC Name | 3,10,12,13,16,16,17-heptamethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthrene |
| SMILES | CC1CCC2(C)C(CCC3C2CC(C)C2(C)C3CC(C)(C)C2C)C1 |
| InChI | InChI=1S/C24H42/c1-15-10-11-23(6)18(12-15)8-9-19-20(23)13-16(2)24(7)17(3)22(4,5)14-21(19)24/h15-21H,8-14H2,1-7H3 |
| InChIKey | CCTNZVDGWBGADP-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |