C20H33ClO — CID 70359591
(8R,9R,10S,13S,14S)-16-chloro-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 70359591) has the molecular formula C20H33ClO and a molecular weight of 324.94 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-16-chloro-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9R,10S,13S,14S)-16-chloro-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 70359591 |
| Molecular Formula | C20H33ClO |
| Molecular Weight | 324.94 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | (8R,9R,10S,13S,14S)-16-chloro-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | CC1CC[C@@]2(C)C(CC[C@@H]3[C@H]2CC[C@]2(C)C(O)C(Cl)C[C@@H]32)C1 |
| InChI | InChI=1S/C20H33ClO/c1-12-6-8-19(2)13(10-12)4-5-14-15(19)7-9-20(3)16(14)11-17(21)18(20)22/h12-18,22H,4-11H2,1-3H3/t12?,13?,14-,15-,16+,17?,18?,19+,20+/m1/s1 |
| InChIKey | MXHDMHHDMCPZFI-LAMSVJLRSA-N |
| XLogP | 5.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.94 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|