C21H31ClO — CID 58356540
(3S,5S,8R,9S,10S,13S,14S)-17-chloro-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-16-carbaldehyde (PubChem CID 58356540) has the molecular formula C21H31ClO and a molecular weight of 334.93 g/mol. Its IUPAC name is (3S,5S,8R,9S,10S,13S,14S)-17-chloro-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-16-carbaldehyde.
| Compound Name | (3S,5S,8R,9S,10S,13S,14S)-17-chloro-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-16-carbaldehyde |
|---|---|
| PubChem CID | 58356540 |
| Molecular Formula | C21H31ClO |
| Molecular Weight | 334.93 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (3S,5S,8R,9S,10S,13S,14S)-17-chloro-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-16-carbaldehyde |
| SMILES | C[C@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)C(Cl)=C(C=O)C[C@@H]32)C1 |
| InChI | InChI=1S/C21H31ClO/c1-13-6-8-20(2)15(10-13)4-5-16-17(20)7-9-21(3)18(16)11-14(12-23)19(21)22/h12-13,15-18H,4-11H2,1-3H3/t13-,15-,16+,17-,18-,20-,21-/m0/s1 |
| InChIKey | QPJHGEXNPQFBTE-BPOASIJYSA-N |
| XLogP | 5.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.93 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|