C25H40O — CID 142478886
(4E)-4-[(3R)-3,10,13-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ylidene]pentanal (PubChem CID 142478886) has the molecular formula C25H40O and a molecular weight of 356.59 g/mol. Its IUPAC name is (4E)-4-[(3R)-3,10,13-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ylidene]pentanal.
| Compound Name | (4E)-4-[(3R)-3,10,13-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ylidene]pentanal |
|---|---|
| PubChem CID | 142478886 |
| Molecular Formula | C25H40O |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 356.31 |
| IUPAC Name | (4E)-4-[(3R)-3,10,13-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ylidene]pentanal |
| SMILES | C/C(CCC=O)=C1/CCC2C3CCC4C[C@H](C)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C25H40O/c1-17-11-13-24(3)19(16-17)7-8-20-22-10-9-21(18(2)6-5-15-26)25(22,4)14-12-23(20)24/h15,17,19-20,22-23H,5-14,16H2,1-4H3/b21-18+/t17-,19?,20?,22?,23?,24?,25?/m1/s1 |
| InChIKey | HASRIVXGEDEXNH-CDJWNAJXSA-N |
| XLogP | 6.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|