C22H34O3 — CID 88916021
(4'R,5'R,13'R,15'R,18'S)-5',15',18'-trimethylspiro[1,3-dioxolane-2,6'-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadecane] (PubChem CID 88916021) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is (4'R,5'R,13'R,15'R,18'S)-5',15',18'-trimethylspiro[1,3-dioxolane-2,6'-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadecane].
| Compound Name | (4'R,5'R,13'R,15'R,18'S)-5',15',18'-trimethylspiro[1,3-dioxolane-2,6'-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadecane] |
|---|---|
| PubChem CID | 88916021 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (4'R,5'R,13'R,15'R,18'S)-5',15',18'-trimethylspiro[1,3-dioxolane-2,6'-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadecane] |
| SMILES | C[C@@H]1CC[C@]2(C)C3C(CC[C@@H]2C1)C1CCC2(OCCO2)[C@@]1(C)[C@H]1OC31 |
| InChI | InChI=1S/C22H34O3/c1-13-6-8-20(2)14(12-13)4-5-15-16-7-9-22(23-10-11-24-22)21(16,3)19-18(25-19)17(15)20/h13-19H,4-12H2,1-3H3/t13-,14-,15?,16?,17?,18?,19+,20+,21-/m1/s1 |
| InChIKey | OMVGJAOSAHAMPN-ADNIMCRGSA-N |
| XLogP | 4.40 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|