C16H30 — CID 174725274
2-(1-ethylcyclohexyl)-1,4-dimethylcyclohexane (PubChem CID 174725274) has the molecular formula C16H30 and a molecular weight of 222.42 g/mol. Its IUPAC name is 2-(1-ethylcyclohexyl)-1,4-dimethylcyclohexane.
| Compound Name | 2-(1-ethylcyclohexyl)-1,4-dimethylcyclohexane |
|---|---|
| PubChem CID | 174725274 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | 2-(1-ethylcyclohexyl)-1,4-dimethylcyclohexane |
| SMILES | CCC1(C2CC(C)CCC2C)CCCCC1 |
| InChI | InChI=1S/C16H30/c1-4-16(10-6-5-7-11-16)15-12-13(2)8-9-14(15)3/h13-15H,4-12H2,1-3H3 |
| InChIKey | KVFNFLVNXRNVAT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |