C16H28 — CID 58376158
(3R,4aR,8aS)-3-methylspiro[2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene-8,1'-cyclohexane] (PubChem CID 58376158) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is (3R,4aR,8aS)-3-methylspiro[2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene-8,1'-cyclohexane].
| Compound Name | (3R,4aR,8aS)-3-methylspiro[2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene-8,1'-cyclohexane] |
|---|---|
| PubChem CID | 58376158 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | (3R,4aR,8aS)-3-methylspiro[2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene-8,1'-cyclohexane] |
| SMILES | C[C@@H]1CC[C@H]2[C@H](CCCC23CCCCC3)C1 |
| InChI | InChI=1S/C16H28/c1-13-7-8-15-14(12-13)6-5-11-16(15)9-3-2-4-10-16/h13-15H,2-12H2,1H3/t13-,14-,15+/m1/s1 |
| InChIKey | QXMIVRSIWGDBOZ-KFWWJZLASA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |