C11H19N — CID 83873409
spiro[bicyclo[4.1.0]heptane-2,3'-piperidine] (PubChem CID 83873409) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is spiro[bicyclo[4.1.0]heptane-2,3'-piperidine].
| Compound Name | spiro[bicyclo[4.1.0]heptane-2,3'-piperidine] |
|---|---|
| PubChem CID | 83873409 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | spiro[bicyclo[4.1.0]heptane-2,3'-piperidine] |
| SMILES | C1CNCC2(C1)CCCC1CC12 |
| InChI | InChI=1S/C11H19N/c1-3-9-7-10(9)11(4-1)5-2-6-12-8-11/h9-10,12H,1-8H2 |
| InChIKey | SZZCLEWTVQDIFR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |