C17H30 — CID 173085788
2-(1-ethylcyclohexyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 173085788) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is 2-(1-ethylcyclohexyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 2-(1-ethylcyclohexyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 173085788 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | 2-(1-ethylcyclohexyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CCC1(C2CC3CCCCC3C2)CCCCC1 |
| InChI | InChI=1S/C17H30/c1-2-17(10-6-3-7-11-17)16-12-14-8-4-5-9-15(14)13-16/h14-16H,2-13H2,1H3 |
| InChIKey | KLFASRHQVSWLFW-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |