C20H30 — CID 163686569
(8R,13S,14S,15R,16R)-13,14,15,16-tetramethylhexacyclo[10.4.0.01,4.04,6.05,8.07,9]hexadecane (PubChem CID 163686569) has the molecular formula C20H30 and a molecular weight of 270.46 g/mol. Its IUPAC name is (8R,13S,14S,15R,16R)-13,14,15,16-tetramethylhexacyclo[10.4.0.01,4.04,6.05,8.07,9]hexadecane.
| Compound Name | (8R,13S,14S,15R,16R)-13,14,15,16-tetramethylhexacyclo[10.4.0.01,4.04,6.05,8.07,9]hexadecane |
|---|---|
| PubChem CID | 163686569 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | (8R,13S,14S,15R,16R)-13,14,15,16-tetramethylhexacyclo[10.4.0.01,4.04,6.05,8.07,9]hexadecane |
| SMILES | C[C@@H]1[C@H](C)[C@H](C)C2CCC3C4C5C([C@H]34)C53CCC23[C@@H]1C |
| InChI | InChI=1S/C20H30/c1-9-10(2)12(4)19-7-8-20(19)17-15-13(16(15)18(17)20)5-6-14(19)11(9)3/h9-18H,5-8H2,1-4H3/t9-,10+,11-,12+,13?,14?,15+,16?,17?,18?,19?,20?/m0/s1 |
| InChIKey | JPJFNDLVKSKJJQ-WBAYJICUSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |