C12H17N — CID 174360020
pentacyclo[6.4.0.02,7.03,6.09,12]dodecan-3-amine (PubChem CID 174360020) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is pentacyclo[6.4.0.02,7.03,6.09,12]dodecan-3-amine.
| Compound Name | pentacyclo[6.4.0.02,7.03,6.09,12]dodecan-3-amine |
|---|---|
| PubChem CID | 174360020 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | pentacyclo[6.4.0.02,7.03,6.09,12]dodecan-3-amine |
| SMILES | NC12CCC1C1C3C4CCC4C3C12 |
| InChI | InChI=1S/C12H17N/c13-12-4-3-7(12)10-8-5-1-2-6(5)9(8)11(10)12/h5-11H,1-4,13H2 |
| InChIKey | UIKNUTBWDGNLTP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|