C18H22 — CID 59762682
(12S)-octacyclo[8.8.0.02,9.03,8.04,7.011,18.012,17.013,16]octadecane (PubChem CID 59762682) has the molecular formula C18H22 and a molecular weight of 238.37 g/mol. Its IUPAC name is (12S)-octacyclo[8.8.0.02,9.03,8.04,7.011,18.012,17.013,16]octadecane.
| Compound Name | (12S)-octacyclo[8.8.0.02,9.03,8.04,7.011,18.012,17.013,16]octadecane |
|---|---|
| PubChem CID | 59762682 |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | (12S)-octacyclo[8.8.0.02,9.03,8.04,7.011,18.012,17.013,16]octadecane |
| SMILES | C1CC2C1C1C2C2C1C1C2C2C1C1C3CCC3[C@@H]12 |
| InChI | InChI=1S/C18H22/c1-2-6-5(1)9-10(6)14-13(9)17-15-11-7-3-4-8(7)12(11)16(15)18(14)17/h5-18H,1-4H2/t5?,6?,7?,8?,9-,10?,11?,12?,13?,14?,15?,16?,17?,18?/m0/s1 |
| InChIKey | WJKPVHAFXXQKGT-QSLFWHMZSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|