C10H12 — CID 90487238
pentacyclo[4.4.0.02,8.03,5.04,7]decane (PubChem CID 90487238) has the molecular formula C10H12 and a molecular weight of 132.21 g/mol. Its IUPAC name is pentacyclo[4.4.0.02,8.03,5.04,7]decane.
| Compound Name | pentacyclo[4.4.0.02,8.03,5.04,7]decane |
|---|---|
| PubChem CID | 90487238 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | pentacyclo[4.4.0.02,8.03,5.04,7]decane |
| SMILES | C1CC2C3C1C1C2C2C3C12 |
| InChI | InChI=1S/C10H12/c1-2-4-5-3(1)6-7(4)10-8(5)9(6)10/h3-10H,1-2H2 |
| InChIKey | PPMYXKZFSJQBQG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |