C14H22 — CID 163578521
3-cyclopentyltricyclo[4.3.0.02,9]nonane (PubChem CID 163578521) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 3-cyclopentyltricyclo[4.3.0.02,9]nonane.
| Compound Name | 3-cyclopentyltricyclo[4.3.0.02,9]nonane |
|---|---|
| PubChem CID | 163578521 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 3-cyclopentyltricyclo[4.3.0.02,9]nonane |
| SMILES | C1CCC(C2CCC3CCC4C3C24)C1 |
| InChI | InChI=1S/C14H22/c1-2-4-9(3-1)11-7-5-10-6-8-12-13(10)14(11)12/h9-14H,1-8H2 |
| InChIKey | GFOWGESTGHMWTC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |