About tetracyclo[6.5.2.04,15.011,14]pentadecane
tetracyclo[6.5.2.04,15.011,14]pentadecane (PubChem CID 91584207) has the molecular formula C15H24
and a molecular weight of 204.36 g/mol. Its IUPAC name is tetracyclo[6.5.2.04,15.011,14]pentadecane.
Molecular Properties
| Compound Name | tetracyclo[6.5.2.04,15.011,14]pentadecane |
| PubChem CID | 91584207 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | tetracyclo[6.5.2.04,15.011,14]pentadecane |
| SMILES | C1CC2CCC3CCC4CCC(C1)C2C34 |
| InChI | InChI=1S/C15H24/c1-2-10-4-6-12-8-9-13-7-5-11(3-1)14(10)15(12)13/h10-15H,1-9H2 |
| InChIKey | LHCKYHZLUCQPJS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tetracyclo[6.5.2.04,15.011,14]pentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracyclo[6.5.2.04,15.011,14]pentadecane?
The IUPAC name of tetracyclo[6.5.2.04,15.011,14]pentadecane (CID 91584207) is tetracyclo[6.5.2.04,15.011,14]pentadecane.
What is the SMILES notation for tetracyclo[6.5.2.04,15.011,14]pentadecane?
The canonical SMILES for tetracyclo[6.5.2.04,15.011,14]pentadecane is C1CC2CCC3CCC4CCC(C1)C2C34.
What is the InChIKey of tetracyclo[6.5.2.04,15.011,14]pentadecane?
The InChIKey is LHCKYHZLUCQPJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24/c1-2-10-4-6-12-8-9-13-7-5-11(3-1)14(10)15(12)13/h10-15H,1-9H2.
What are the key properties of tetracyclo[6.5.2.04,15.011,14]pentadecane?
tetracyclo[6.5.2.04,15.011,14]pentadecane has a molecular weight of 204.36 g/mol, XLogP of 4.25, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetracyclo[6.5.2.04,15.011,14]pentadecane is sourced from PubChem (CID 91584207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).