C21H38 — CID 18716323
1,2,3,4,5-pentamethyl-4-[(1,2,3,4,5-pentamethylcyclopentyl)methyl]cyclopentene (PubChem CID 18716323) has the molecular formula C21H38 and a molecular weight of 290.54 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethyl-4-[(1,2,3,4,5-pentamethylcyclopentyl)methyl]cyclopentene.
| Compound Name | 1,2,3,4,5-pentamethyl-4-[(1,2,3,4,5-pentamethylcyclopentyl)methyl]cyclopentene |
|---|---|
| PubChem CID | 18716323 |
| Molecular Formula | C21H38 |
| Molecular Weight | 290.54 g/mol |
| Exact Mass | 290.30 |
| IUPAC Name | 1,2,3,4,5-pentamethyl-4-[(1,2,3,4,5-pentamethylcyclopentyl)methyl]cyclopentene |
| SMILES | CC1=C(C)C(C)C(C)(CC2(C)C(C)C(C)C(C)C2C)C1C |
| InChI | InChI=1S/C21H38/c1-12-13(2)17(6)20(9,16(12)5)11-21(10)18(7)14(3)15(4)19(21)8/h12-13,16-19H,11H2,1-10H3 |
| InChIKey | UZQQPKVCMGTLSH-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.54 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|