C12H23N — CID 143547151
4-ethyl-3,4,5-trimethyl-2-methylidenecyclohexan-1-amine (PubChem CID 143547151) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is 4-ethyl-3,4,5-trimethyl-2-methylidenecyclohexan-1-amine.
| Compound Name | 4-ethyl-3,4,5-trimethyl-2-methylidenecyclohexan-1-amine |
|---|---|
| PubChem CID | 143547151 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 4-ethyl-3,4,5-trimethyl-2-methylidenecyclohexan-1-amine |
| SMILES | C=C1C(N)CC(C)C(C)(CC)C1C |
| InChI | InChI=1S/C12H23N/c1-6-12(5)8(2)7-11(13)9(3)10(12)4/h8,10-11H,3,6-7,13H2,1-2,4-5H3 |
| InChIKey | CDRVWICPMCCYCL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|