C8H10O2 — CID 143325335
(4S,5R)-5-ethynyl-4,5-dimethyloxolan-2-one (PubChem CID 143325335) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is (4S,5R)-5-ethynyl-4,5-dimethyloxolan-2-one.
| Compound Name | (4S,5R)-5-ethynyl-4,5-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 143325335 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | (4S,5R)-5-ethynyl-4,5-dimethyloxolan-2-one |
| SMILES | C#C[C@]1(C)OC(=O)C[C@@H]1C |
| InChI | InChI=1S/C8H10O2/c1-4-8(3)6(2)5-7(9)10-8/h1,6H,5H2,2-3H3/t6-,8-/m0/s1 |
| InChIKey | LBHMAORLMBNJFX-XPUUQOCRSA-N |
| XLogP | 0.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|