C11H20O2 — CID 10845202
(2S,3R,5S,9R)-2,3,9-trimethyl-1,10-dioxaspiro[4.5]decane (PubChem CID 10845202) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (2S,3R,5S,9R)-2,3,9-trimethyl-1,10-dioxaspiro[4.5]decane.
| Compound Name | (2S,3R,5S,9R)-2,3,9-trimethyl-1,10-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 10845202 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (2S,3R,5S,9R)-2,3,9-trimethyl-1,10-dioxaspiro[4.5]decane |
| SMILES | C[C@@H]1CCC[C@]2(C[C@@H](C)[C@H](C)O2)O1 |
| InChI | InChI=1S/C11H20O2/c1-8-7-11(13-10(8)3)6-4-5-9(2)12-11/h8-10H,4-7H2,1-3H3/t8-,9-,10+,11+/m1/s1 |
| InChIKey | PBZWOIIDGPYCJH-ZNSHCXBVSA-N |
| XLogP | 2.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |