C24H33NO4 — CID 59456485
N-[3-[(2S,6S,8S)-2-but-3-enyl-1,7-dioxaspiro[5.5]undecan-8-yl]propyl]-2-formylbenzamide (PubChem CID 59456485) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is N-[3-[(2S,6S,8S)-2-but-3-enyl-1,7-dioxaspiro[5.5]undecan-8-yl]propyl]-2-formylbenzamide.
| Compound Name | N-[3-[(2S,6S,8S)-2-but-3-enyl-1,7-dioxaspiro[5.5]undecan-8-yl]propyl]-2-formylbenzamide |
|---|---|
| PubChem CID | 59456485 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | N-[3-[(2S,6S,8S)-2-but-3-enyl-1,7-dioxaspiro[5.5]undecan-8-yl]propyl]-2-formylbenzamide |
| SMILES | C=CCC[C@@H]1CCC[C@]2(CCC[C@@H](CCCNC(=O)c3ccccc3C=O)O2)O1 |
| InChI | InChI=1S/C24H33NO4/c1-2-3-10-20-11-6-15-24(28-20)16-7-12-21(29-24)13-8-17-25-23(27)22-14-5-4-9-19(22)18-26/h2,4-5,9,14,18,20-21H,1,3,6-8,10-13,15-17H2,(H,25,27)/t20-,21+,24+/m1/s1 |
| InChIKey | BVIOTJOZSKUNTP-DPLHUUCSSA-N |
| XLogP | 4.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|