C17H19NO2 — CID 142265185
2-formyl-N-[(3E,5Z)-3-methylocta-3,5,7-trienyl]benzamide (PubChem CID 142265185) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-formyl-N-[(3E,5Z)-3-methylocta-3,5,7-trienyl]benzamide.
| Compound Name | 2-formyl-N-[(3E,5Z)-3-methylocta-3,5,7-trienyl]benzamide |
|---|---|
| PubChem CID | 142265185 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-formyl-N-[(3E,5Z)-3-methylocta-3,5,7-trienyl]benzamide |
| SMILES | C=C/C=C\C=C(/C)CCNC(=O)c1ccccc1C=O |
| InChI | InChI=1S/C17H19NO2/c1-3-4-5-8-14(2)11-12-18-17(20)16-10-7-6-9-15(16)13-19/h3-10,13H,1,11-12H2,2H3,(H,18,20)/b5-4-,14-8+ |
| InChIKey | SHYBVJIZZKREKT-HNQGTOQISA-N |
| XLogP | 3.31 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|