C17H30INO2 — CID 102092384
(4R,6S)-6-hexyl-4-(4-iodobutyl)-2,2-dimethyl-1,3-dioxane-4-carbonitrile (PubChem CID 102092384) has the molecular formula C17H30INO2 and a molecular weight of 407.34 g/mol. Its IUPAC name is (4R,6S)-6-hexyl-4-(4-iodobutyl)-2,2-dimethyl-1,3-dioxane-4-carbonitrile.
| Compound Name | (4R,6S)-6-hexyl-4-(4-iodobutyl)-2,2-dimethyl-1,3-dioxane-4-carbonitrile |
|---|---|
| PubChem CID | 102092384 |
| Molecular Formula | C17H30INO2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (4R,6S)-6-hexyl-4-(4-iodobutyl)-2,2-dimethyl-1,3-dioxane-4-carbonitrile |
| SMILES | CCCCCC[C@H]1C[C@@](C#N)(CCCCI)OC(C)(C)O1 |
| InChI | InChI=1S/C17H30INO2/c1-4-5-6-7-10-15-13-17(14-19,11-8-9-12-18)21-16(2,3)20-15/h15H,4-13H2,1-3H3/t15-,17+/m0/s1 |
| InChIKey | ILNDYLADSACWBK-DOTOQJQBSA-N |
| XLogP | 5.37 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|