C17H32O3 — CID 16727790
(1S,2R,6S)-2-heptyl-1-hexyl-3,4,7-trioxabicyclo[4.1.0]heptane (PubChem CID 16727790) has the molecular formula C17H32O3 and a molecular weight of 284.44 g/mol. Its IUPAC name is (1S,2R,6S)-2-heptyl-1-hexyl-3,4,7-trioxabicyclo[4.1.0]heptane.
| Compound Name | (1S,2R,6S)-2-heptyl-1-hexyl-3,4,7-trioxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 16727790 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | (1S,2R,6S)-2-heptyl-1-hexyl-3,4,7-trioxabicyclo[4.1.0]heptane |
| SMILES | CCCCCCC[C@H]1OOC[C@@H]2O[C@@]21CCCCCC |
| InChI | InChI=1S/C17H32O3/c1-3-5-7-9-10-12-15-17(13-11-8-6-4-2)16(19-17)14-18-20-15/h15-16H,3-14H2,1-2H3/t15-,16+,17-/m1/s1 |
| InChIKey | BSMYIKWSFYVOFD-IXDOHACOSA-N |
| XLogP | 4.79 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|