C49H92O11 — CID 59236976
1-hexyl-3,5,7,9,11,13,15-heptapentyl-2,4,6,8,10,12,14,16,17,18,19-undecaoxatetracyclo[9.5.1.13,9.15,15]nonadecane (PubChem CID 59236976) has the molecular formula C49H92O11 and a molecular weight of 857.26 g/mol. Its IUPAC name is 1-hexyl-3,5,7,9,11,13,15-heptapentyl-2,4,6,8,10,12,14,16,17,18,19-undecaoxatetracyclo[9.5.1.13,9.15,15]nonadecane.
| Compound Name | 1-hexyl-3,5,7,9,11,13,15-heptapentyl-2,4,6,8,10,12,14,16,17,18,19-undecaoxatetracyclo[9.5.1.13,9.15,15]nonadecane |
|---|---|
| PubChem CID | 59236976 |
| Molecular Formula | C49H92O11 |
| Molecular Weight | 857.26 g/mol |
| Exact Mass | 856.66 |
| IUPAC Name | 1-hexyl-3,5,7,9,11,13,15-heptapentyl-2,4,6,8,10,12,14,16,17,18,19-undecaoxatetracyclo[9.5.1.13,9.15,15]nonadecane |
| SMILES | CCCCCCC12OC3(CCCCC)OC(CCCCC)OC(CCCCC)(OC4(CCCCC)OC(CCCCC)OC(CCCCC)(O3)OC(CCCCC)(O4)O1)O2 |
| InChI | InChI=1S/C49H92O11/c1-9-17-25-33-41-49-58-46(38-30-22-14-6)52-43(35-27-19-11-3)53-47(59-49,39-31-23-15-7)55-45(37-29-21-13-5)51-42(34-26-18-10-2)50-44(54-46,36-28-20-12-4)56-48(57-45,60-49)40-32-24-16-8/h42-43H,9-41H2,1-8H3 |
| InChIKey | KNJSNMHRWRKWDW-UHFFFAOYSA-N |
| XLogP | 14.83 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.26 |
| LogP ≤ 5 | 14.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|