C17H31NO2 — CID 102070124
(4S,6R)-4-butyl-6-hexyl-2,2-dimethyl-1,3-dioxane-4-carbonitrile (PubChem CID 102070124) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is (4S,6R)-4-butyl-6-hexyl-2,2-dimethyl-1,3-dioxane-4-carbonitrile.
| Compound Name | (4S,6R)-4-butyl-6-hexyl-2,2-dimethyl-1,3-dioxane-4-carbonitrile |
|---|---|
| PubChem CID | 102070124 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | (4S,6R)-4-butyl-6-hexyl-2,2-dimethyl-1,3-dioxane-4-carbonitrile |
| SMILES | CCCCCC[C@@H]1C[C@](C#N)(CCCC)OC(C)(C)O1 |
| InChI | InChI=1S/C17H31NO2/c1-5-7-9-10-11-15-13-17(14-18,12-8-6-2)20-16(3,4)19-15/h15H,5-13H2,1-4H3/t15-,17+/m1/s1 |
| InChIKey | DGTUSQGOSXCTSC-WBVHZDCISA-N |
| XLogP | 4.95 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|