C15H28O4SSi — CID 139700390
methyl 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-oxothiane-2-carboxylate (PubChem CID 139700390) has the molecular formula C15H28O4SSi and a molecular weight of 332.54 g/mol. Its IUPAC name is methyl 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-oxothiane-2-carboxylate.
| Compound Name | methyl 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-oxothiane-2-carboxylate |
|---|---|
| PubChem CID | 139700390 |
| Molecular Formula | C15H28O4SSi |
| Molecular Weight | 332.54 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | methyl 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-oxothiane-2-carboxylate |
| SMILES | COC(=O)C1SCCC(CCO[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C15H28O4SSi/c1-15(2,3)21(5,6)19-9-7-11-8-10-20-13(12(11)16)14(17)18-4/h11,13H,7-10H2,1-6H3 |
| InChIKey | XNKDDRXMERZSCL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|