C17H34O3S2Si — CID 11222682
2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-(1,3-dithian-2-yl)-3-hydroxypentan-1-one (PubChem CID 11222682) has the molecular formula C17H34O3S2Si and a molecular weight of 378.68 g/mol. Its IUPAC name is 2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-(1,3-dithian-2-yl)-3-hydroxypentan-1-one.
| Compound Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-(1,3-dithian-2-yl)-3-hydroxypentan-1-one |
|---|---|
| PubChem CID | 11222682 |
| Molecular Formula | C17H34O3S2Si |
| Molecular Weight | 378.68 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-(1,3-dithian-2-yl)-3-hydroxypentan-1-one |
| SMILES | CCC(O)C(CCO[Si](C)(C)C(C)(C)C)C(=O)C1SCCCS1 |
| InChI | InChI=1S/C17H34O3S2Si/c1-7-14(18)13(15(19)16-21-11-8-12-22-16)9-10-20-23(5,6)17(2,3)4/h13-14,16,18H,7-12H2,1-6H3 |
| InChIKey | YMKYFBWUMYWSQA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.68 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|