C19H34Cl2O2Si — CID 15053013
6-[5-[tert-butyl(dimethyl)silyl]oxypentyl]-3,3-dichloro-1,3a,4,5,6,6a-hexahydropentalen-2-one (PubChem CID 15053013) has the molecular formula C19H34Cl2O2Si and a molecular weight of 393.47 g/mol. Its IUPAC name is 6-[5-[tert-butyl(dimethyl)silyl]oxypentyl]-3,3-dichloro-1,3a,4,5,6,6a-hexahydropentalen-2-one.
| Compound Name | 6-[5-[tert-butyl(dimethyl)silyl]oxypentyl]-3,3-dichloro-1,3a,4,5,6,6a-hexahydropentalen-2-one |
|---|---|
| PubChem CID | 15053013 |
| Molecular Formula | C19H34Cl2O2Si |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 6-[5-[tert-butyl(dimethyl)silyl]oxypentyl]-3,3-dichloro-1,3a,4,5,6,6a-hexahydropentalen-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCC1CCC2C1CC(=O)C2(Cl)Cl |
| InChI | InChI=1S/C19H34Cl2O2Si/c1-18(2,3)24(4,5)23-12-8-6-7-9-14-10-11-16-15(14)13-17(22)19(16,20)21/h14-16H,6-13H2,1-5H3 |
| InChIKey | YHJBFHLBERIXCE-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|