C18H31NOSi — CID 152675325
tert-butyl-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propoxy]-dimethylsilane (PubChem CID 152675325) has the molecular formula C18H31NOSi and a molecular weight of 305.54 g/mol. Its IUPAC name is tert-butyl-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propoxy]-dimethylsilane |
|---|---|
| PubChem CID | 152675325 |
| Molecular Formula | C18H31NOSi |
| Molecular Weight | 305.54 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | tert-butyl-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C18H31NOSi/c1-18(2,3)21(4,5)20-14-8-12-19-13-11-16-9-6-7-10-17(16)15-19/h6-7,9-10H,8,11-15H2,1-5H3 |
| InChIKey | ZMKAWEUBQAODFG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|