C16H18F7NO — CID 90718439
2-[3-(2,2,3,3,4,4,4-heptafluorobutoxy)propyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 90718439) has the molecular formula C16H18F7NO and a molecular weight of 373.31 g/mol. Its IUPAC name is 2-[3-(2,2,3,3,4,4,4-heptafluorobutoxy)propyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-[3-(2,2,3,3,4,4,4-heptafluorobutoxy)propyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 90718439 |
| Molecular Formula | C16H18F7NO |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2-[3-(2,2,3,3,4,4,4-heptafluorobutoxy)propyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)COCCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H18F7NO/c17-14(18,15(19,20)16(21,22)23)11-25-9-3-7-24-8-6-12-4-1-2-5-13(12)10-24/h1-2,4-5H,3,6-11H2 |
| InChIKey | KBIWELJOWROMKL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|