C13H16N2 — CID 3340858
2-(3-isocyanopropyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 3340858) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-(3-isocyanopropyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(3-isocyanopropyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 3340858 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-(3-isocyanopropyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | [C-]#[N+]CCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C13H16N2/c1-14-8-4-9-15-10-7-12-5-2-3-6-13(12)11-15/h2-3,5-6H,4,7-11H2 |
| InChIKey | SXEBIRCHJNLHIA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 7.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|