C14H18O4 — CID 11097002
(3R,4R)-4-(4-hydroxybutyl)-3-phenylmethoxyoxetan-2-one (PubChem CID 11097002) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (3R,4R)-4-(4-hydroxybutyl)-3-phenylmethoxyoxetan-2-one.
| Compound Name | (3R,4R)-4-(4-hydroxybutyl)-3-phenylmethoxyoxetan-2-one |
|---|---|
| PubChem CID | 11097002 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (3R,4R)-4-(4-hydroxybutyl)-3-phenylmethoxyoxetan-2-one |
| SMILES | O=C1O[C@H](CCCCO)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C14H18O4/c15-9-5-4-8-12-13(14(16)18-12)17-10-11-6-2-1-3-7-11/h1-3,6-7,12-13,15H,4-5,8-10H2/t12-,13-/m1/s1 |
| InChIKey | BAFOCVZJLINJHN-CHWSQXEVSA-N |
| XLogP | 1.66 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|