C30H39NNaO5P+2 — CID 11214956
sodium methyl-[(E)-7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoxy]-oxophosphanium (PubChem CID 11214956) has the molecular formula C30H39NNaO5P+2 and a molecular weight of 547.61 g/mol. Its IUPAC name is sodium methyl-[(E)-7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoxy]-oxophosphanium.
| Compound Name | sodium methyl-[(E)-7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoxy]-oxophosphanium |
|---|---|
| PubChem CID | 11214956 |
| Molecular Formula | C30H39NNaO5P+2 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | sodium methyl-[(E)-7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoxy]-oxophosphanium |
| SMILES | C[P+](=O)OCCC/C=C/CC[C@H]1[C@@H](OCc2ccc(-c3ccccc3)cc2)CC(=O)[C@@H]1N1CCOCC1.[Na+] |
| InChI | InChI=1S/C30H39NO5P.Na/c1-37(33)36-19-9-4-2-3-8-12-27-29(22-28(32)30(27)31-17-20-34-21-18-31)35-23-24-13-15-26(16-14-24)25-10-6-5-7-11-25;/h2-3,5-7,10-11,13-16,27,29-30H,4,8-9,12,17-23H2,1H3;/q2*+1/b3-2+;/t27-,29-,30+;/m0./s1 |
| InChIKey | XOBCZMPIBPZZNE-YYHORZGASA-N |
| XLogP | 3.04 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|