C33H44N2O5 — CID 54454060
2-(dimethylamino)ethyl 7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoate (PubChem CID 54454060) has the molecular formula C33H44N2O5 and a molecular weight of 548.72 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoate.
| Compound Name | 2-(dimethylamino)ethyl 7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoate |
|---|---|
| PubChem CID | 54454060 |
| Molecular Formula | C33H44N2O5 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.33 |
| IUPAC Name | 2-(dimethylamino)ethyl 7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoate |
| SMILES | CN(C)CCOC(=O)CCC=CCC[C@H]1[C@@H](OCc2ccc(-c3ccccc3)cc2)CC(=O)[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C33H44N2O5/c1-34(2)18-23-39-32(37)13-9-4-3-8-12-29-31(24-30(36)33(29)35-19-21-38-22-20-35)40-25-26-14-16-28(17-15-26)27-10-6-5-7-11-27/h3-7,10-11,14-17,29,31,33H,8-9,12-13,18-25H2,1-2H3/t29-,31-,33+/m0/s1 |
| InChIKey | WWYBFGINIYXGQE-FXFVSWTPSA-N |
| XLogP | 4.75 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|