C29H36NO5P — CID 11466346
methyl-[6-[2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hex-3-ynyl]phosphinic acid (PubChem CID 11466346) has the molecular formula C29H36NO5P and a molecular weight of 509.58 g/mol. Its IUPAC name is methyl-[6-[2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hex-3-ynyl]phosphinic acid.
| Compound Name | methyl-[6-[2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hex-3-ynyl]phosphinic acid |
|---|---|
| PubChem CID | 11466346 |
| Molecular Formula | C29H36NO5P |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | methyl-[6-[2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hex-3-ynyl]phosphinic acid |
| SMILES | CP(=O)(O)CCC#CCCC1C(OCc2ccc(-c3ccccc3)cc2)CC(=O)C1N1CCOCC1 |
| InChI | InChI=1S/C29H36NO5P/c1-36(32,33)20-8-3-2-7-11-26-28(21-27(31)29(26)30-16-18-34-19-17-30)35-22-23-12-14-25(15-13-23)24-9-5-4-6-10-24/h4-6,9-10,12-15,26,28-29H,7-8,11,16-22H2,1H3,(H,32,33) |
| InChIKey | WDHITKDIMPHMON-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|