C24H34N2O4 — CID 70507196
(Z)-7-[(1S,2S,5R)-5-[(4-aminophenyl)methoxy]-3-oxo-2-piperidin-1-ylcyclopentyl]hept-5-enoic acid (PubChem CID 70507196) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is (Z)-7-[(1S,2S,5R)-5-[(4-aminophenyl)methoxy]-3-oxo-2-piperidin-1-ylcyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2S,5R)-5-[(4-aminophenyl)methoxy]-3-oxo-2-piperidin-1-ylcyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70507196 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | (Z)-7-[(1S,2S,5R)-5-[(4-aminophenyl)methoxy]-3-oxo-2-piperidin-1-ylcyclopentyl]hept-5-enoic acid |
| SMILES | Nc1ccc(CO[C@@H]2CC(=O)[C@@H](N3CCCCC3)[C@@H]2C/C=C\CCCC(=O)O)cc1 |
| InChI | InChI=1S/C24H34N2O4/c25-19-12-10-18(11-13-19)17-30-22-16-21(27)24(26-14-6-3-7-15-26)20(22)8-4-1-2-5-9-23(28)29/h1,4,10-13,20,22,24H,2-3,5-9,14-17,25H2,(H,28,29)/b4-1-/t20-,22-,24+/m1/s1 |
| InChIKey | HKYOMIBRKLGWIW-VIOAXKIZSA-N |
| XLogP | 3.80 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|