C28H37NO3 — CID 13393888
(E)-7-[2-(naphthalen-2-ylmethoxy)-5-piperidin-1-ylcyclopentyl]hept-4-enoic acid (PubChem CID 13393888) has the molecular formula C28H37NO3 and a molecular weight of 435.61 g/mol. Its IUPAC name is (E)-7-[2-(naphthalen-2-ylmethoxy)-5-piperidin-1-ylcyclopentyl]hept-4-enoic acid.
| Compound Name | (E)-7-[2-(naphthalen-2-ylmethoxy)-5-piperidin-1-ylcyclopentyl]hept-4-enoic acid |
|---|---|
| PubChem CID | 13393888 |
| Molecular Formula | C28H37NO3 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | (E)-7-[2-(naphthalen-2-ylmethoxy)-5-piperidin-1-ylcyclopentyl]hept-4-enoic acid |
| SMILES | O=C(O)CC/C=C/CCC1C(OCc2ccc3ccccc3c2)CCC1N1CCCCC1 |
| InChI | InChI=1S/C28H37NO3/c30-28(31)13-5-2-1-4-12-25-26(29-18-8-3-9-19-29)16-17-27(25)32-21-22-14-15-23-10-6-7-11-24(23)20-22/h1-2,6-7,10-11,14-15,20,25-27H,3-5,8-9,12-13,16-19,21H2,(H,30,31)/b2-1+ |
| InChIKey | WIIPNNTUYUHQJS-OWOJBTEDSA-N |
| XLogP | 6.19 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|