C31H41NO5 — CID 14371756
(Z)-6-[(1R,2S,5R)-2-(azepan-1-yl)-5-[[4-[2-(hydroxymethyl)phenyl]phenyl]methoxy]cyclopentyl]oxyhex-4-enoic acid (PubChem CID 14371756) has the molecular formula C31H41NO5 and a molecular weight of 507.67 g/mol. Its IUPAC name is (Z)-6-[(1R,2S,5R)-2-(azepan-1-yl)-5-[[4-[2-(hydroxymethyl)phenyl]phenyl]methoxy]cyclopentyl]oxyhex-4-enoic acid.
| Compound Name | (Z)-6-[(1R,2S,5R)-2-(azepan-1-yl)-5-[[4-[2-(hydroxymethyl)phenyl]phenyl]methoxy]cyclopentyl]oxyhex-4-enoic acid |
|---|---|
| PubChem CID | 14371756 |
| Molecular Formula | C31H41NO5 |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | (Z)-6-[(1R,2S,5R)-2-(azepan-1-yl)-5-[[4-[2-(hydroxymethyl)phenyl]phenyl]methoxy]cyclopentyl]oxyhex-4-enoic acid |
| SMILES | O=C(O)CC/C=C\CO[C@H]1[C@H](OCc2ccc(-c3ccccc3CO)cc2)CC[C@@H]1N1CCCCCC1 |
| InChI | InChI=1S/C31H41NO5/c33-22-26-10-5-6-11-27(26)25-15-13-24(14-16-25)23-37-29-18-17-28(32-19-7-1-2-8-20-32)31(29)36-21-9-3-4-12-30(34)35/h3,5-6,9-11,13-16,28-29,31,33H,1-2,4,7-8,12,17-23H2,(H,34,35)/b9-3-/t28-,29+,31+/m0/s1 |
| InChIKey | KCLYPNKWGQYJSE-JCOFVJCZSA-N |
| XLogP | 5.58 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|