C31H41NO4 — CID 70393170
(Z)-6-[(1R,2S,5S)-2-[3-(4-phenylphenyl)propoxy]-5-piperidin-1-ylcyclopentyl]oxyhex-4-enoic acid (PubChem CID 70393170) has the molecular formula C31H41NO4 and a molecular weight of 491.67 g/mol. Its IUPAC name is (Z)-6-[(1R,2S,5S)-2-[3-(4-phenylphenyl)propoxy]-5-piperidin-1-ylcyclopentyl]oxyhex-4-enoic acid.
| Compound Name | (Z)-6-[(1R,2S,5S)-2-[3-(4-phenylphenyl)propoxy]-5-piperidin-1-ylcyclopentyl]oxyhex-4-enoic acid |
|---|---|
| PubChem CID | 70393170 |
| Molecular Formula | C31H41NO4 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | (Z)-6-[(1R,2S,5S)-2-[3-(4-phenylphenyl)propoxy]-5-piperidin-1-ylcyclopentyl]oxyhex-4-enoic acid |
| SMILES | O=C(O)CC/C=C\CO[C@H]1[C@@H](OCCCc2ccc(-c3ccccc3)cc2)CC[C@@H]1N1CCCCC1 |
| InChI | InChI=1S/C31H41NO4/c33-30(34)14-6-2-9-23-36-31-28(32-21-7-3-8-22-32)19-20-29(31)35-24-10-11-25-15-17-27(18-16-25)26-12-4-1-5-13-26/h1-2,4-5,9,12-13,15-18,28-29,31H,3,6-8,10-11,14,19-24H2,(H,33,34)/b9-2-/t28-,29-,31+/m0/s1 |
| InChIKey | YPOSGAAIRGOCRV-XNCMRRJISA-N |
| XLogP | 6.13 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|