C28H37NO3S — CID 54123135
7-[(1R,2S,5S)-2-piperidin-1-yl-5-[(4-thiophen-2-ylphenyl)methoxy]cyclopentyl]hept-4-enoic acid (PubChem CID 54123135) has the molecular formula C28H37NO3S and a molecular weight of 467.68 g/mol. Its IUPAC name is 7-[(1R,2S,5S)-2-piperidin-1-yl-5-[(4-thiophen-2-ylphenyl)methoxy]cyclopentyl]hept-4-enoic acid.
| Compound Name | 7-[(1R,2S,5S)-2-piperidin-1-yl-5-[(4-thiophen-2-ylphenyl)methoxy]cyclopentyl]hept-4-enoic acid |
|---|---|
| PubChem CID | 54123135 |
| Molecular Formula | C28H37NO3S |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 7-[(1R,2S,5S)-2-piperidin-1-yl-5-[(4-thiophen-2-ylphenyl)methoxy]cyclopentyl]hept-4-enoic acid |
| SMILES | O=C(O)CCC=CCC[C@H]1[C@@H](OCc2ccc(-c3cccs3)cc2)CC[C@@H]1N1CCCCC1 |
| InChI | InChI=1S/C28H37NO3S/c30-28(31)11-5-2-1-4-9-24-25(29-18-6-3-7-19-29)16-17-26(24)32-21-22-12-14-23(15-13-22)27-10-8-20-33-27/h1-2,8,10,12-15,20,24-26H,3-7,9,11,16-19,21H2,(H,30,31)/t24-,25+,26+/m1/s1 |
| InChIKey | NPCSTNHYKHCTLO-ZNZIZOMTSA-N |
| XLogP | 6.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|