C31H39NO6 — CID 54336841
2-[4-[[(1S,2S,3R)-3-(azepan-1-yl)-2-(5-carboxypent-2-enoxy)cyclopentyl]oxymethyl]phenyl]benzoic acid (PubChem CID 54336841) has the molecular formula C31H39NO6 and a molecular weight of 521.65 g/mol. Its IUPAC name is 2-[4-[[(1S,2S,3R)-3-(azepan-1-yl)-2-(5-carboxypent-2-enoxy)cyclopentyl]oxymethyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[(1S,2S,3R)-3-(azepan-1-yl)-2-(5-carboxypent-2-enoxy)cyclopentyl]oxymethyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 54336841 |
| Molecular Formula | C31H39NO6 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | 2-[4-[[(1S,2S,3R)-3-(azepan-1-yl)-2-(5-carboxypent-2-enoxy)cyclopentyl]oxymethyl]phenyl]benzoic acid |
| SMILES | O=C(O)CCC=CCO[C@@H]1[C@@H](OCc2ccc(-c3ccccc3C(=O)O)cc2)CC[C@H]1N1CCCCCC1 |
| InChI | InChI=1S/C31H39NO6/c33-29(34)12-4-3-9-21-37-30-27(32-19-7-1-2-8-20-32)17-18-28(30)38-22-23-13-15-24(16-14-23)25-10-5-6-11-26(25)31(35)36/h3,5-6,9-11,13-16,27-28,30H,1-2,4,7-8,12,17-22H2,(H,33,34)(H,35,36)/t27-,28+,30+/m1/s1 |
| InChIKey | TWBHOWLPCFQYIZ-UNRZKBSHSA-N |
| XLogP | 5.78 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|