C28H37NO3S — CID 70469969
7-[2-[(5-phenylthiophen-3-yl)methoxy]-5-piperidin-1-ylcyclopentyl]hept-4-enoic acid (PubChem CID 70469969) has the molecular formula C28H37NO3S and a molecular weight of 467.68 g/mol. Its IUPAC name is 7-[2-[(5-phenylthiophen-3-yl)methoxy]-5-piperidin-1-ylcyclopentyl]hept-4-enoic acid.
| Compound Name | 7-[2-[(5-phenylthiophen-3-yl)methoxy]-5-piperidin-1-ylcyclopentyl]hept-4-enoic acid |
|---|---|
| PubChem CID | 70469969 |
| Molecular Formula | C28H37NO3S |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 7-[2-[(5-phenylthiophen-3-yl)methoxy]-5-piperidin-1-ylcyclopentyl]hept-4-enoic acid |
| SMILES | O=C(O)CCC=CCCC1C(OCc2csc(-c3ccccc3)c2)CCC1N1CCCCC1 |
| InChI | InChI=1S/C28H37NO3S/c30-28(31)14-8-2-1-7-13-24-25(29-17-9-4-10-18-29)15-16-26(24)32-20-22-19-27(33-21-22)23-11-5-3-6-12-23/h1-3,5-6,11-12,19,21,24-26H,4,7-10,13-18,20H2,(H,30,31) |
| InChIKey | CZSDPOLDOATXKK-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|