C18H23FN2O6S — CID 67797215
(Z)-6-[(1R,2R,5S)-2-fluoro-5-[[(2-nitrophenyl)sulfonylamino]methyl]cyclopentyl]hex-4-enoic acid (PubChem CID 67797215) has the molecular formula C18H23FN2O6S and a molecular weight of 414.46 g/mol. Its IUPAC name is (Z)-6-[(1R,2R,5S)-2-fluoro-5-[[(2-nitrophenyl)sulfonylamino]methyl]cyclopentyl]hex-4-enoic acid.
| Compound Name | (Z)-6-[(1R,2R,5S)-2-fluoro-5-[[(2-nitrophenyl)sulfonylamino]methyl]cyclopentyl]hex-4-enoic acid |
|---|---|
| PubChem CID | 67797215 |
| Molecular Formula | C18H23FN2O6S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | (Z)-6-[(1R,2R,5S)-2-fluoro-5-[[(2-nitrophenyl)sulfonylamino]methyl]cyclopentyl]hex-4-enoic acid |
| SMILES | O=C(O)CC/C=C\C[C@@H]1[C@@H](CNS(=O)(=O)c2ccccc2[N+](=O)[O-])CC[C@H]1F |
| InChI | InChI=1S/C18H23FN2O6S/c19-15-11-10-13(14(15)6-2-1-3-9-18(22)23)12-20-28(26,27)17-8-5-4-7-16(17)21(24)25/h1-2,4-5,7-8,13-15,20H,3,6,9-12H2,(H,22,23)/b2-1-/t13-,14-,15-/m1/s1 |
| InChIKey | RHBYKWDHJYIYKD-PDAPNNNUSA-N |
| XLogP | 3.05 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|