C18H26F3NO3 — CID 88651085
(Z)-7-[(1S,2S,3S,5R)-6,6-dimethyl-3-[(2,2,2-trifluoroacetyl)amino]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid (PubChem CID 88651085) has the molecular formula C18H26F3NO3 and a molecular weight of 361.40 g/mol. Its IUPAC name is (Z)-7-[(1S,2S,3S,5R)-6,6-dimethyl-3-[(2,2,2-trifluoroacetyl)amino]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2S,3S,5R)-6,6-dimethyl-3-[(2,2,2-trifluoroacetyl)amino]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 88651085 |
| Molecular Formula | C18H26F3NO3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | (Z)-7-[(1S,2S,3S,5R)-6,6-dimethyl-3-[(2,2,2-trifluoroacetyl)amino]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
| SMILES | CC1(C)[C@H]2C[C@H](NC(=O)C(F)(F)F)[C@@H](C/C=C\CCCC(=O)O)[C@@H]1C2 |
| InChI | InChI=1S/C18H26F3NO3/c1-17(2)11-9-13(17)12(7-5-3-4-6-8-15(23)24)14(10-11)22-16(25)18(19,20)21/h3,5,11-14H,4,6-10H2,1-2H3,(H,22,25)(H,23,24)/b5-3-/t11-,12+,13+,14+/m1/s1 |
| InChIKey | JJRARRCUNOZDDC-QJUWZJFNSA-N |
| XLogP | 3.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|