C22H37NO4S — CID 54477889
7-[(1S,5R)-3-(hex-1-enoxysulfinylamino)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid (PubChem CID 54477889) has the molecular formula C22H37NO4S and a molecular weight of 411.61 g/mol. Its IUPAC name is 7-[(1S,5R)-3-(hex-1-enoxysulfinylamino)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid.
| Compound Name | 7-[(1S,5R)-3-(hex-1-enoxysulfinylamino)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54477889 |
| Molecular Formula | C22H37NO4S |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 7-[(1S,5R)-3-(hex-1-enoxysulfinylamino)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
| SMILES | CCCCC=COS(=O)NC1C[C@H]2C[C@@H](C1CC=CCCCC(=O)O)C2(C)C |
| InChI | InChI=1S/C22H37NO4S/c1-4-5-6-11-14-27-28(26)23-20-16-17-15-19(22(17,2)3)18(20)12-9-7-8-10-13-21(24)25/h7,9,11,14,17-20,23H,4-6,8,10,12-13,15-16H2,1-3H3,(H,24,25)/t17-,18?,19+,20?,28?/m1/s1 |
| InChIKey | XMWJMBUXJDJMFX-BOKGWTPOSA-N |
| XLogP | 5.13 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|