C25H35NO4S — CID 67705181
(Z)-7-[6,6-dimethyl-3-[2-(3-methylphenyl)ethenylsulfonylamino]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid (PubChem CID 67705181) has the molecular formula C25H35NO4S and a molecular weight of 445.63 g/mol. Its IUPAC name is (Z)-7-[6,6-dimethyl-3-[2-(3-methylphenyl)ethenylsulfonylamino]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[6,6-dimethyl-3-[2-(3-methylphenyl)ethenylsulfonylamino]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67705181 |
| Molecular Formula | C25H35NO4S |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | (Z)-7-[6,6-dimethyl-3-[2-(3-methylphenyl)ethenylsulfonylamino]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
| SMILES | Cc1cccc(C=CS(=O)(=O)NC2CC3CC(C2C/C=C\CCCC(=O)O)C3(C)C)c1 |
| InChI | InChI=1S/C25H35NO4S/c1-18-9-8-10-19(15-18)13-14-31(29,30)26-23-17-20-16-22(25(20,2)3)21(23)11-6-4-5-7-12-24(27)28/h4,6,8-10,13-15,20-23,26H,5,7,11-12,16-17H2,1-3H3,(H,27,28)/b6-4-,14-13? |
| InChIKey | MALNOQVMUFQPIZ-QFFFXMIGSA-N |
| XLogP | 5.14 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|