C22H26N2O6S — CID 54270773
7-[3-[2-(3-nitrophenyl)ethenylsulfonylamino]-2-bicyclo[2.2.1]hept-5-enyl]hept-5-enoic acid (PubChem CID 54270773) has the molecular formula C22H26N2O6S and a molecular weight of 446.53 g/mol. Its IUPAC name is 7-[3-[2-(3-nitrophenyl)ethenylsulfonylamino]-2-bicyclo[2.2.1]hept-5-enyl]hept-5-enoic acid.
| Compound Name | 7-[3-[2-(3-nitrophenyl)ethenylsulfonylamino]-2-bicyclo[2.2.1]hept-5-enyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54270773 |
| Molecular Formula | C22H26N2O6S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 7-[3-[2-(3-nitrophenyl)ethenylsulfonylamino]-2-bicyclo[2.2.1]hept-5-enyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CCC1C2C=CC(C2)C1NS(=O)(=O)C=Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H26N2O6S/c25-21(26)9-4-2-1-3-8-20-17-10-11-18(15-17)22(20)23-31(29,30)13-12-16-6-5-7-19(14-16)24(27)28/h1,3,5-7,10-14,17-18,20,22-23H,2,4,8-9,15H2,(H,25,26) |
| InChIKey | RJYMSVMGZXEYNC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|