C23H30INO4S — CID 18797971
(E)-7-[3-[[(E)-2-(3-iodophenyl)ethenyl]sulfonylamino]-2-bicyclo[2.2.2]octanyl]hept-5-enoic acid (PubChem CID 18797971) has the molecular formula C23H30INO4S and a molecular weight of 543.47 g/mol. Its IUPAC name is (E)-7-[3-[[(E)-2-(3-iodophenyl)ethenyl]sulfonylamino]-2-bicyclo[2.2.2]octanyl]hept-5-enoic acid.
| Compound Name | (E)-7-[3-[[(E)-2-(3-iodophenyl)ethenyl]sulfonylamino]-2-bicyclo[2.2.2]octanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 18797971 |
| Molecular Formula | C23H30INO4S |
| Molecular Weight | 543.47 g/mol |
| Exact Mass | 543.09 |
| IUPAC Name | (E)-7-[3-[[(E)-2-(3-iodophenyl)ethenyl]sulfonylamino]-2-bicyclo[2.2.2]octanyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C/CC1C2CCC(CC2)C1NS(=O)(=O)/C=C/c1cccc(I)c1 |
| InChI | InChI=1S/C23H30INO4S/c24-20-7-5-6-17(16-20)14-15-30(28,29)25-23-19-12-10-18(11-13-19)21(23)8-3-1-2-4-9-22(26)27/h1,3,5-7,14-16,18-19,21,23,25H,2,4,8-13H2,(H,26,27)/b3-1+,15-14+ |
| InChIKey | ZJBHAGCHEVMIQX-ONEZXHGESA-N |
| XLogP | 5.19 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|